C20H20ClN — CID 6857873
(3Z)-3-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)-N,N-dimethylpropan-1-amine (PubChem CID 6857873) has the molecular formula C20H20ClN and a molecular weight of 309.84 g/mol. Its IUPAC name is (3Z)-3-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)-N,N-dimethylpropan-1-amine.
| Compound Name | (3Z)-3-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 6857873 |
| Molecular Formula | C20H20ClN |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (3Z)-3-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CC/C=C1/c2ccccc2C=Cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C20H20ClN/c1-22(2)13-5-8-19-18-7-4-3-6-15(18)9-10-16-11-12-17(21)14-20(16)19/h3-4,6-12,14H,5,13H2,1-2H3/b19-8- |
| InChIKey | QQMRDCBPRWBCIV-UWVJOHFNSA-N |
| XLogP | 5.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|