C25H28N4O — CID 68578913
3-[8-[1-(1H-imidazol-5-yl)-2-phenylethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide (PubChem CID 68578913) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is 3-[8-[1-(1H-imidazol-5-yl)-2-phenylethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide.
| Compound Name | 3-[8-[1-(1H-imidazol-5-yl)-2-phenylethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
|---|---|
| PubChem CID | 68578913 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 3-[8-[1-(1H-imidazol-5-yl)-2-phenylethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
| SMILES | NC(=O)c1cccc(C2CC3CCC(C2)N3C(Cc2ccccc2)c2cnc[nH]2)c1 |
| InChI | InChI=1S/C25H28N4O/c26-25(30)19-8-4-7-18(12-19)20-13-21-9-10-22(14-20)29(21)24(23-15-27-16-28-23)11-17-5-2-1-3-6-17/h1-8,12,15-16,20-22,24H,9-11,13-14H2,(H2,26,30)(H,27,28) |
| InChIKey | OINSRATUMOZNBT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |