C19H16N2O3 — CID 68579752
2-(1H-indole-5-carbonyl)-3,4-dihydro-1H-isoquinoline-7-carboxylic acid (PubChem CID 68579752) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-(1H-indole-5-carbonyl)-3,4-dihydro-1H-isoquinoline-7-carboxylic acid.
| Compound Name | 2-(1H-indole-5-carbonyl)-3,4-dihydro-1H-isoquinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 68579752 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-(1H-indole-5-carbonyl)-3,4-dihydro-1H-isoquinoline-7-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)CN(C(=O)c1ccc3[nH]ccc3c1)CC2 |
| InChI | InChI=1S/C19H16N2O3/c22-18(14-3-4-17-13(9-14)5-7-20-17)21-8-6-12-1-2-15(19(23)24)10-16(12)11-21/h1-5,7,9-10,20H,6,8,11H2,(H,23,24) |
| InChIKey | FKHFKOWTCUOITJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |