C19H26O2 — CID 68580794
(4aS,10aR)-4a-[(E)-but-2-enyl]-7-methoxy-1,3,4,5,8,9,10,10a-octahydrophenanthren-2-one (PubChem CID 68580794) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is (4aS,10aR)-4a-[(E)-but-2-enyl]-7-methoxy-1,3,4,5,8,9,10,10a-octahydrophenanthren-2-one.
| Compound Name | (4aS,10aR)-4a-[(E)-but-2-enyl]-7-methoxy-1,3,4,5,8,9,10,10a-octahydrophenanthren-2-one |
|---|---|
| PubChem CID | 68580794 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (4aS,10aR)-4a-[(E)-but-2-enyl]-7-methoxy-1,3,4,5,8,9,10,10a-octahydrophenanthren-2-one |
| SMILES | C/C=C/C[C@@]12CCC(=O)C[C@H]1CCC1=C2CC=C(OC)C1 |
| InChI | InChI=1S/C19H26O2/c1-3-4-10-19-11-9-16(20)13-15(19)6-5-14-12-17(21-2)7-8-18(14)19/h3-4,7,15H,5-6,8-13H2,1-2H3/b4-3+/t15-,19-/m1/s1 |
| InChIKey | SJHDJAFBDNEZPK-QSYSNMATSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|