C22H24Cl2N4O6S — CID 68581624
N-[(2S)-3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-2-hydroxypropyl]-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 68581624) has the molecular formula C22H24Cl2N4O6S and a molecular weight of 543.43 g/mol. Its IUPAC name is N-[(2S)-3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-2-hydroxypropyl]-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | N-[(2S)-3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-2-hydroxypropyl]-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 68581624 |
| Molecular Formula | C22H24Cl2N4O6S |
| Molecular Weight | 543.43 g/mol |
| Exact Mass | 542.08 |
| IUPAC Name | N-[(2S)-3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-2-hydroxypropyl]-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)NC[C@@H](O)CN3CCC(Oc4ccc(Cl)c(Cl)c4)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C22H24Cl2N4O6S/c23-17-3-1-15(9-18(17)24)34-14-5-7-28(8-6-14)12-13(29)11-25-35(32,33)16-2-4-19-20(10-16)27-22(31)21(30)26-19/h1-4,9-10,13-14,25,29H,5-8,11-12H2,(H,26,30)(H,27,31)/t13-/m1/s1 |
| InChIKey | JFZOOMYVRYUGMZ-CYBMUJFWSA-N |
| XLogP | 1.71 |
| TPSA | 144.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|