C19H22N2O3S — CID 68582394
N-[(1R,3S)-2,2-dimethyl-3-(4-sulfamoylphenyl)cyclopropyl]-4-methylbenzamide (PubChem CID 68582394) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is N-[(1R,3S)-2,2-dimethyl-3-(4-sulfamoylphenyl)cyclopropyl]-4-methylbenzamide.
| Compound Name | N-[(1R,3S)-2,2-dimethyl-3-(4-sulfamoylphenyl)cyclopropyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 68582394 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-[(1R,3S)-2,2-dimethyl-3-(4-sulfamoylphenyl)cyclopropyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H]2[C@@H](c3ccc(S(N)(=O)=O)cc3)C2(C)C)cc1 |
| InChI | InChI=1S/C19H22N2O3S/c1-12-4-6-14(7-5-12)18(22)21-17-16(19(17,2)3)13-8-10-15(11-9-13)25(20,23)24/h4-11,16-17H,1-3H3,(H,21,22)(H2,20,23,24)/t16-,17-/m1/s1 |
| InChIKey | BKTCHTSQMHKXMB-IAGOWNOFSA-N |
| XLogP | 2.56 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |