About ethylcycloheptane;2-methylprop-2-enoic acid
ethylcycloheptane;2-methylprop-2-enoic acid (PubChem CID 68583536) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is ethylcycloheptane;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | ethylcycloheptane;2-methylprop-2-enoic acid |
| PubChem CID | 68583536 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | ethylcycloheptane;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCC1CCCCCC1 |
| InChI | InChI=1S/C9H18.C4H6O2/c1-2-9-7-5-3-4-6-8-9;1-3(2)4(5)6/h9H,2-8H2,1H3;1H2,2H3,(H,5,6) |
| InChIKey | NMYGMSUOCGRVIC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethylcycloheptane;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylcycloheptane;2-methylprop-2-enoic acid?
The IUPAC name of ethylcycloheptane;2-methylprop-2-enoic acid (CID 68583536) is ethylcycloheptane;2-methylprop-2-enoic acid.
What is the SMILES notation for ethylcycloheptane;2-methylprop-2-enoic acid?
The canonical SMILES for ethylcycloheptane;2-methylprop-2-enoic acid is C=C(C)C(=O)O.CCC1CCCCCC1.
What is the InChIKey of ethylcycloheptane;2-methylprop-2-enoic acid?
The InChIKey is NMYGMSUOCGRVIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C4H6O2/c1-2-9-7-5-3-4-6-8-9;1-3(2)4(5)6/h9H,2-8H2,1H3;1H2,2H3,(H,5,6).
What are the key properties of ethylcycloheptane;2-methylprop-2-enoic acid?
ethylcycloheptane;2-methylprop-2-enoic acid has a molecular weight of 212.33 g/mol, XLogP of 4.01, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethylcycloheptane;2-methylprop-2-enoic acid is sourced from PubChem (CID 68583536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).