C22H25N3O6 — CID 68584446
ethyl 2-methyl-7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-ynyl]-10-oxo-4-oxa-1,2-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-11-carboxylate (PubChem CID 68584446) has the molecular formula C22H25N3O6 and a molecular weight of 427.46 g/mol. Its IUPAC name is ethyl 2-methyl-7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-ynyl]-10-oxo-4-oxa-1,2-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-11-carboxylate.
| Compound Name | ethyl 2-methyl-7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-ynyl]-10-oxo-4-oxa-1,2-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 68584446 |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | ethyl 2-methyl-7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-ynyl]-10-oxo-4-oxa-1,2-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-11-carboxylate |
| SMILES | CCOC(=O)c1cn2c3c(cc(CC#CNC(=O)OC(C)(C)C)cc3c1=O)OCN2C |
| InChI | InChI=1S/C22H25N3O6/c1-6-29-20(27)16-12-25-18-15(19(16)26)10-14(11-17(18)30-13-24(25)5)8-7-9-23-21(28)31-22(2,3)4/h10-12H,6,8,13H2,1-5H3,(H,23,28) |
| InChIKey | AHXKJHDGQNPBCO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|