C26H30N4O — CID 68584519
cyclopentene;7-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-5-methyl-6-phenyl-1,3-benzoxazole-4-carbonitrile (PubChem CID 68584519) has the molecular formula C26H30N4O and a molecular weight of 414.55 g/mol. Its IUPAC name is cyclopentene;7-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-5-methyl-6-phenyl-1,3-benzoxazole-4-carbonitrile.
| Compound Name | cyclopentene;7-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-5-methyl-6-phenyl-1,3-benzoxazole-4-carbonitrile |
|---|---|
| PubChem CID | 68584519 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | cyclopentene;7-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-5-methyl-6-phenyl-1,3-benzoxazole-4-carbonitrile |
| SMILES | C1=CCCC1.Cc1c(-c2ccccc2)c(N2CC[C@H](N(C)C)C2)c2ocnc2c1C#N |
| InChI | InChI=1S/C21H22N4O.C5H8/c1-14-17(11-22)19-21(26-13-23-19)20(18(14)15-7-5-4-6-8-15)25-10-9-16(12-25)24(2)3;1-2-4-5-3-1/h4-8,13,16H,9-10,12H2,1-3H3;1-2H,3-5H2/t16-;/m0./s1 |
| InChIKey | HKQWGWDTFYUGTD-NTISSMGPSA-N |
| XLogP | 5.54 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|