C20H23N5O2 — CID 86630875
2-amino-4-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-6-methyl-3-nitro-5-phenylbenzonitrile (PubChem CID 86630875) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-amino-4-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-6-methyl-3-nitro-5-phenylbenzonitrile.
| Compound Name | 2-amino-4-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-6-methyl-3-nitro-5-phenylbenzonitrile |
|---|---|
| PubChem CID | 86630875 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-amino-4-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-6-methyl-3-nitro-5-phenylbenzonitrile |
| SMILES | Cc1c(C#N)c(N)c([N+](=O)[O-])c(N2CC[C@H](N(C)C)C2)c1-c1ccccc1 |
| InChI | InChI=1S/C20H23N5O2/c1-13-16(11-21)18(22)20(25(26)27)19(17(13)14-7-5-4-6-8-14)24-10-9-15(12-24)23(2)3/h4-8,15H,9-10,12,22H2,1-3H3/t15-/m0/s1 |
| InChIKey | ILBXNFVEGBDPLL-HNNXBMFYSA-N |
| XLogP | 3.16 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|