C30H24N6O15 — CID 68584918
dimethyl 1-[4,6-bis[2,6-bis(methoxycarbonyl)-4-oxo-1-pyridinyl]-1,3,5-triazin-2-yl]-4-oxopyridine-2,6-dicarboxylate (PubChem CID 68584918) has the molecular formula C30H24N6O15 and a molecular weight of 708.55 g/mol. Its IUPAC name is dimethyl 1-[4,6-bis[2,6-bis(methoxycarbonyl)-4-oxo-1-pyridinyl]-1,3,5-triazin-2-yl]-4-oxopyridine-2,6-dicarboxylate.
| Compound Name | dimethyl 1-[4,6-bis[2,6-bis(methoxycarbonyl)-4-oxo-1-pyridinyl]-1,3,5-triazin-2-yl]-4-oxopyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 68584918 |
| Molecular Formula | C30H24N6O15 |
| Molecular Weight | 708.55 g/mol |
| Exact Mass | 708.13 |
| IUPAC Name | dimethyl 1-[4,6-bis[2,6-bis(methoxycarbonyl)-4-oxo-1-pyridinyl]-1,3,5-triazin-2-yl]-4-oxopyridine-2,6-dicarboxylate |
| SMILES | COC(=O)c1cc(=O)cc(C(=O)OC)n1-c1nc(-n2c(C(=O)OC)cc(=O)cc2C(=O)OC)nc(-n2c(C(=O)OC)cc(=O)cc2C(=O)OC)n1 |
| InChI | InChI=1S/C30H24N6O15/c1-46-22(40)16-7-13(37)8-17(23(41)47-2)34(16)28-31-29(35-18(24(42)48-3)9-14(38)10-19(35)25(43)49-4)33-30(32-28)36-20(26(44)50-5)11-15(39)12-21(36)27(45)51-6/h7-12H,1-6H3 |
| InChIKey | STQNBNLYIQAQSL-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 262.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.55 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|