C28H26N2O5 — CID 68585265
(2S)-2-[2-(methoxymethyl)-7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)quinolin-6-yl]-2-prop-1-en-2-yloxyacetic acid (PubChem CID 68585265) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is (2S)-2-[2-(methoxymethyl)-7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)quinolin-6-yl]-2-prop-1-en-2-yloxyacetic acid.
| Compound Name | (2S)-2-[2-(methoxymethyl)-7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)quinolin-6-yl]-2-prop-1-en-2-yloxyacetic acid |
|---|---|
| PubChem CID | 68585265 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | (2S)-2-[2-(methoxymethyl)-7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)quinolin-6-yl]-2-prop-1-en-2-yloxyacetic acid |
| SMILES | C=C(C)O[C@H](C(=O)O)c1c(C)cc2nc(COC)ccc2c1-c1ccc2c3c(ccnc13)CCO2 |
| InChI | InChI=1S/C28H26N2O5/c1-15(2)35-27(28(31)32)23-16(3)13-21-19(6-5-18(30-21)14-33-4)25(23)20-7-8-22-24-17(10-12-34-22)9-11-29-26(20)24/h5-9,11,13,27H,1,10,12,14H2,2-4H3,(H,31,32)/t27-/m0/s1 |
| InChIKey | ZHJQTBRFGMANRW-MHZLTWQESA-N |
| XLogP | 5.52 |
| TPSA | 90.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|