About CID 68585978
CID 68585978 (PubChem CID 68585978) has the molecular formula C56H84O5Si2
and a molecular weight of 893.46 g/mol.
Molecular Properties
| Compound Name | CID 68585978 |
| PubChem CID | 68585978 |
| Molecular Formula | C56H84O5Si2 |
| Molecular Weight | 893.46 g/mol |
| Exact Mass | 892.59 |
| IUPAC Name | — |
| SMILES | CCCCCC(C)(C)Oc1cccc([Si](O[Si](c2cccc(OC(C)(C)CCCCC)c2)c2cccc(OC(C)(C)CCCCC)c2)c2cccc(OC(C)(C)CCCCC)c2)c1 |
| InChI | InChI=1S/C56H84O5Si2/c1-13-17-21-37-53(5,6)57-45-29-25-33-49(41-45)62(50-34-26-30-46(42-50)58-54(7,8)38-22-18-14-2)61-63(51-35-27-31-47(43-51)59-55(9,10)39-23-19-15-3)52-36-28-32-48(44-52)60-56(11,12)40-24-20-16-4/h25-36,41-44H,13-24,37-40H2,1-12H3 |
| InChIKey | QRBPCQSDBSMRMJ-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 893.46 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68585978 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68585978?
The IUPAC name of CID 68585978 (CID 68585978) is not available.
What is the SMILES notation for CID 68585978?
The canonical SMILES for CID 68585978 is CCCCCC(C)(C)Oc1cccc([Si](O[Si](c2cccc(OC(C)(C)CCCCC)c2)c2cccc(OC(C)(C)CCCCC)c2)c2cccc(OC(C)(C)CCCCC)c2)c1.
What is the InChIKey of CID 68585978?
The InChIKey is QRBPCQSDBSMRMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C56H84O5Si2/c1-13-17-21-37-53(5,6)57-45-29-25-33-49(41-45)62(50-34-26-30-46(42-50)58-54(7,8)38-22-18-14-2)61-63(51-35-27-31-47(43-51)59-55(9,10)39-23-19-15-3)52-36-28-32-48(44-52)60-56(11,12)40-24-20-16-4/h25-36,41-44H,13-24,37-40H2,1-12H3.
What are the key properties of CID 68585978?
CID 68585978 has a molecular weight of 893.46 g/mol, XLogP of 13.57, 30 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68585978 is sourced from PubChem (CID 68585978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).