C22H25ClN4O3 — CID 68586967
methyl 1-benzyl-3-carbamoyl-4-piperazin-1-ylindole-2-carboxylate;hydrochloride (PubChem CID 68586967) has the molecular formula C22H25ClN4O3 and a molecular weight of 428.92 g/mol. Its IUPAC name is methyl 1-benzyl-3-carbamoyl-4-piperazin-1-ylindole-2-carboxylate;hydrochloride.
| Compound Name | methyl 1-benzyl-3-carbamoyl-4-piperazin-1-ylindole-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 68586967 |
| Molecular Formula | C22H25ClN4O3 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | methyl 1-benzyl-3-carbamoyl-4-piperazin-1-ylindole-2-carboxylate;hydrochloride |
| SMILES | COC(=O)c1c(C(N)=O)c2c(N3CCNCC3)cccc2n1Cc1ccccc1.Cl |
| InChI | InChI=1S/C22H24N4O3.ClH/c1-29-22(28)20-19(21(23)27)18-16(25-12-10-24-11-13-25)8-5-9-17(18)26(20)14-15-6-3-2-4-7-15;/h2-9,24H,10-14H2,1H3,(H2,23,27);1H |
| InChIKey | WIPGRTRYFDDGMO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |