C38H34F3N3O2Si — CID 68591062
6-[tert-butyl(diphenyl)silyl]oxy-N-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]naphthalene-1-carboxamide (PubChem CID 68591062) has the molecular formula C38H34F3N3O2Si and a molecular weight of 649.79 g/mol. Its IUPAC name is 6-[tert-butyl(diphenyl)silyl]oxy-N-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]naphthalene-1-carboxamide.
| Compound Name | 6-[tert-butyl(diphenyl)silyl]oxy-N-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 68591062 |
| Molecular Formula | C38H34F3N3O2Si |
| Molecular Weight | 649.79 g/mol |
| Exact Mass | 649.24 |
| IUPAC Name | 6-[tert-butyl(diphenyl)silyl]oxy-N-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]naphthalene-1-carboxamide |
| SMILES | Cc1cn(-c2cc(NC(=O)c3cccc4cc(O[Si](c5ccccc5)(c5ccccc5)C(C)(C)C)ccc34)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C38H34F3N3O2Si/c1-26-24-44(25-42-26)30-22-28(38(39,40)41)21-29(23-30)43-36(45)35-17-11-12-27-20-31(18-19-34(27)35)46-47(37(2,3)4,32-13-7-5-8-14-32)33-15-9-6-10-16-33/h5-25H,1-4H3,(H,43,45) |
| InChIKey | WYODTABKJKHHLK-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.79 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|