C16H13FN2O — CID 68593869
6-fluoro-3-phenyl-2,3,3a,4-tetrahydrochromeno[4,3-c]pyrazole (PubChem CID 68593869) has the molecular formula C16H13FN2O and a molecular weight of 268.29 g/mol. Its IUPAC name is 6-fluoro-3-phenyl-2,3,3a,4-tetrahydrochromeno[4,3-c]pyrazole.
| Compound Name | 6-fluoro-3-phenyl-2,3,3a,4-tetrahydrochromeno[4,3-c]pyrazole |
|---|---|
| PubChem CID | 68593869 |
| Molecular Formula | C16H13FN2O |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 6-fluoro-3-phenyl-2,3,3a,4-tetrahydrochromeno[4,3-c]pyrazole |
| SMILES | Fc1cccc2c1OCC1C2=NNC1c1ccccc1 |
| InChI | InChI=1S/C16H13FN2O/c17-13-8-4-7-11-15-12(9-20-16(11)13)14(18-19-15)10-5-2-1-3-6-10/h1-8,12,14,18H,9H2 |
| InChIKey | UDPWIAPTXHUJSD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |