C21H32ClN3O — CID 68596517
[4-(4-chloroanilino)cyclohexyl]-(3-methyl-4-propan-2-ylpiperazin-1-yl)methanone (PubChem CID 68596517) has the molecular formula C21H32ClN3O and a molecular weight of 377.96 g/mol. Its IUPAC name is [4-(4-chloroanilino)cyclohexyl]-(3-methyl-4-propan-2-ylpiperazin-1-yl)methanone.
| Compound Name | [4-(4-chloroanilino)cyclohexyl]-(3-methyl-4-propan-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 68596517 |
| Molecular Formula | C21H32ClN3O |
| Molecular Weight | 377.96 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | [4-(4-chloroanilino)cyclohexyl]-(3-methyl-4-propan-2-ylpiperazin-1-yl)methanone |
| SMILES | CC(C)N1CCN(C(=O)C2CCC(Nc3ccc(Cl)cc3)CC2)CC1C |
| InChI | InChI=1S/C21H32ClN3O/c1-15(2)25-13-12-24(14-16(25)3)21(26)17-4-8-19(9-5-17)23-20-10-6-18(22)7-11-20/h6-7,10-11,15-17,19,23H,4-5,8-9,12-14H2,1-3H3 |
| InChIKey | OXOFXHSJHAXTEG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.96 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |