C21H29NO7 — CID 68597231
1-O-tert-butyl 4-O-methyl (2R)-2-[benzyl-[(2R)-1-methoxy-1-oxopropan-2-yl]carbamoyl]butanedioate (PubChem CID 68597231) has the molecular formula C21H29NO7 and a molecular weight of 407.46 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-methyl (2R)-2-[benzyl-[(2R)-1-methoxy-1-oxopropan-2-yl]carbamoyl]butanedioate.
| Compound Name | 1-O-tert-butyl 4-O-methyl (2R)-2-[benzyl-[(2R)-1-methoxy-1-oxopropan-2-yl]carbamoyl]butanedioate |
|---|---|
| PubChem CID | 68597231 |
| Molecular Formula | C21H29NO7 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 1-O-tert-butyl 4-O-methyl (2R)-2-[benzyl-[(2R)-1-methoxy-1-oxopropan-2-yl]carbamoyl]butanedioate |
| SMILES | COC(=O)C[C@@H](C(=O)OC(C)(C)C)C(=O)N(Cc1ccccc1)[C@H](C)C(=O)OC |
| InChI | InChI=1S/C21H29NO7/c1-14(19(25)28-6)22(13-15-10-8-7-9-11-15)18(24)16(12-17(23)27-5)20(26)29-21(2,3)4/h7-11,14,16H,12-13H2,1-6H3/t14-,16-/m1/s1 |
| InChIKey | XAKGRJJLAIQBQF-GDBMZVCRSA-N |
| XLogP | 2.10 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|