C13H21N3O3S — CID 68598587
N-[1-(diethylamino)ethyl]-4-sulfamoylbenzamide (PubChem CID 68598587) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is N-[1-(diethylamino)ethyl]-4-sulfamoylbenzamide.
| Compound Name | N-[1-(diethylamino)ethyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 68598587 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-[1-(diethylamino)ethyl]-4-sulfamoylbenzamide |
| SMILES | CCN(CC)C(C)NC(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H21N3O3S/c1-4-16(5-2)10(3)15-13(17)11-6-8-12(9-7-11)20(14,18)19/h6-10H,4-5H2,1-3H3,(H,15,17)(H2,14,18,19) |
| InChIKey | YAFNEAKFRLLFJY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|