C18H24N6O4 — CID 68599351
methyl (2S,3R)-3-(2-amino-2-carbamimidoyliminoethyl)-3-methyl-4-oxo-1-[[(1R)-1-phenylethyl]carbamoyl]azetidine-2-carboxylate (PubChem CID 68599351) has the molecular formula C18H24N6O4 and a molecular weight of 388.43 g/mol. Its IUPAC name is methyl (2S,3R)-3-(2-amino-2-carbamimidoyliminoethyl)-3-methyl-4-oxo-1-[[(1R)-1-phenylethyl]carbamoyl]azetidine-2-carboxylate.
| Compound Name | methyl (2S,3R)-3-(2-amino-2-carbamimidoyliminoethyl)-3-methyl-4-oxo-1-[[(1R)-1-phenylethyl]carbamoyl]azetidine-2-carboxylate |
|---|---|
| PubChem CID | 68599351 |
| Molecular Formula | C18H24N6O4 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | methyl (2S,3R)-3-(2-amino-2-carbamimidoyliminoethyl)-3-methyl-4-oxo-1-[[(1R)-1-phenylethyl]carbamoyl]azetidine-2-carboxylate |
| SMILES | [H]/N=C(\N)N=C(N)C[C@@]1(C)C(=O)N(C(=O)N[C@H](C)c2ccccc2)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C18H24N6O4/c1-10(11-7-5-4-6-8-11)22-17(27)24-13(14(25)28-3)18(2,15(24)26)9-12(19)23-16(20)21/h4-8,10,13H,9H2,1-3H3,(H,22,27)(H5,19,20,21,23)/t10-,13-,18-/m1/s1 |
| InChIKey | KULXWUJZMVTSGE-AJAPIDPKSA-N |
| XLogP | 0.49 |
| TPSA | 163.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|