C29H30N2O4 — CID 118299710
(2S,3R)-N-benzhydryl-2-(1-hydroxyethenyl)-3-[2-(4-methoxyphenyl)ethyl]-3-methyl-4-oxoazetidine-1-carboxamide (PubChem CID 118299710) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is (2S,3R)-N-benzhydryl-2-(1-hydroxyethenyl)-3-[2-(4-methoxyphenyl)ethyl]-3-methyl-4-oxoazetidine-1-carboxamide.
| Compound Name | (2S,3R)-N-benzhydryl-2-(1-hydroxyethenyl)-3-[2-(4-methoxyphenyl)ethyl]-3-methyl-4-oxoazetidine-1-carboxamide |
|---|---|
| PubChem CID | 118299710 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | (2S,3R)-N-benzhydryl-2-(1-hydroxyethenyl)-3-[2-(4-methoxyphenyl)ethyl]-3-methyl-4-oxoazetidine-1-carboxamide |
| SMILES | C=C(O)[C@H]1N(C(=O)NC(c2ccccc2)c2ccccc2)C(=O)[C@]1(C)CCc1ccc(OC)cc1 |
| InChI | InChI=1S/C29H30N2O4/c1-20(32)26-29(2,19-18-21-14-16-24(35-3)17-15-21)27(33)31(26)28(34)30-25(22-10-6-4-7-11-22)23-12-8-5-9-13-23/h4-17,25-26,32H,1,18-19H2,2-3H3,(H,30,34)/t26-,29-/m1/s1 |
| InChIKey | MLMGTGZMTMWYMN-GGXMVOPNSA-N |
| XLogP | 5.42 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|