C21H23N3O4 — CID 51592551
N-[(S)-(4-methoxyphenyl)-phenylmethyl]-3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]propanamide (PubChem CID 51592551) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is N-[(S)-(4-methoxyphenyl)-phenylmethyl]-3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]propanamide.
| Compound Name | N-[(S)-(4-methoxyphenyl)-phenylmethyl]-3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]propanamide |
|---|---|
| PubChem CID | 51592551 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-[(S)-(4-methoxyphenyl)-phenylmethyl]-3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]propanamide |
| SMILES | COc1ccc([C@@H](NC(=O)CC[C@@]2(C)NC(=O)NC2=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23N3O4/c1-21(19(26)23-20(27)24-21)13-12-17(25)22-18(14-6-4-3-5-7-14)15-8-10-16(28-2)11-9-15/h3-11,18H,12-13H2,1-2H3,(H,22,25)(H2,23,24,26,27)/t18-,21+/m0/s1 |
| InChIKey | CSGDTTSRGVEEPP-GHTZIAJQSA-N |
| XLogP | 2.28 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|