C21H24N4O2 — CID 68599915
4-(2-amino-4-ethoxyquinazolin-6-yl)-N-butylbenzamide (PubChem CID 68599915) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-(2-amino-4-ethoxyquinazolin-6-yl)-N-butylbenzamide.
| Compound Name | 4-(2-amino-4-ethoxyquinazolin-6-yl)-N-butylbenzamide |
|---|---|
| PubChem CID | 68599915 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4-(2-amino-4-ethoxyquinazolin-6-yl)-N-butylbenzamide |
| SMILES | CCCCNC(=O)c1ccc(-c2ccc3nc(N)nc(OCC)c3c2)cc1 |
| InChI | InChI=1S/C21H24N4O2/c1-3-5-12-23-19(26)15-8-6-14(7-9-15)16-10-11-18-17(13-16)20(27-4-2)25-21(22)24-18/h6-11,13H,3-5,12H2,1-2H3,(H,23,26)(H2,22,24,25) |
| InChIKey | SDKAPWJIVPGAIG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|