C21H25N5O2 — CID 68602035
4-(2-amino-4-ethoxyquinazolin-6-yl)-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 68602035) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-(2-amino-4-ethoxyquinazolin-6-yl)-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 4-(2-amino-4-ethoxyquinazolin-6-yl)-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 68602035 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 4-(2-amino-4-ethoxyquinazolin-6-yl)-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | CCOc1nc(N)nc2ccc(-c3ccc(C(=O)NCCN(C)C)cc3)cc12 |
| InChI | InChI=1S/C21H25N5O2/c1-4-28-20-17-13-16(9-10-18(17)24-21(22)25-20)14-5-7-15(8-6-14)19(27)23-11-12-26(2)3/h5-10,13H,4,11-12H2,1-3H3,(H,23,27)(H2,22,24,25) |
| InChIKey | QXTSUIUGXNLUPR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |