C22H25F3N6O2 — CID 68604955
2-methyl-6-(4-methylpiperazin-1-yl)-9-(oxolan-3-yl)-8-[2-(trifluoromethoxy)phenyl]purine (PubChem CID 68604955) has the molecular formula C22H25F3N6O2 and a molecular weight of 462.48 g/mol. Its IUPAC name is 2-methyl-6-(4-methylpiperazin-1-yl)-9-(oxolan-3-yl)-8-[2-(trifluoromethoxy)phenyl]purine.
| Compound Name | 2-methyl-6-(4-methylpiperazin-1-yl)-9-(oxolan-3-yl)-8-[2-(trifluoromethoxy)phenyl]purine |
|---|---|
| PubChem CID | 68604955 |
| Molecular Formula | C22H25F3N6O2 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 2-methyl-6-(4-methylpiperazin-1-yl)-9-(oxolan-3-yl)-8-[2-(trifluoromethoxy)phenyl]purine |
| SMILES | Cc1nc(N2CCN(C)CC2)c2nc(-c3ccccc3OC(F)(F)F)n(C3CCOC3)c2n1 |
| InChI | InChI=1S/C22H25F3N6O2/c1-14-26-20(30-10-8-29(2)9-11-30)18-21(27-14)31(15-7-12-32-13-15)19(28-18)16-5-3-4-6-17(16)33-22(23,24)25/h3-6,15H,7-13H2,1-2H3 |
| InChIKey | NCWKJTTYEPGNAO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |