C23H26Cl2N6O2 — CID 68604984
2-[8-(2-chlorophenyl)-2-methyl-9-[(3S)-oxolan-3-yl]purin-6-yl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one;hydrochloride (PubChem CID 68604984) has the molecular formula C23H26Cl2N6O2 and a molecular weight of 489.41 g/mol. Its IUPAC name is 2-[8-(2-chlorophenyl)-2-methyl-9-[(3S)-oxolan-3-yl]purin-6-yl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one;hydrochloride.
| Compound Name | 2-[8-(2-chlorophenyl)-2-methyl-9-[(3S)-oxolan-3-yl]purin-6-yl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one;hydrochloride |
|---|---|
| PubChem CID | 68604984 |
| Molecular Formula | C23H26Cl2N6O2 |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 2-[8-(2-chlorophenyl)-2-methyl-9-[(3S)-oxolan-3-yl]purin-6-yl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one;hydrochloride |
| SMILES | Cc1nc(N2CCN3C(=O)CCC3C2)c2nc(-c3ccccc3Cl)n([C@H]3CCOC3)c2n1.Cl |
| InChI | InChI=1S/C23H25ClN6O2.ClH/c1-14-25-22(28-9-10-29-15(12-28)6-7-19(29)31)20-23(26-14)30(16-8-11-32-13-16)21(27-20)17-4-2-3-5-18(17)24;/h2-5,15-16H,6-13H2,1H3;1H/t15?,16-;/m0./s1 |
| InChIKey | DMPNSYPEPMBEDS-UFUZRDLVSA-N |
| XLogP | 3.65 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |