C18H20N2O2 — CID 68605942
6-amino-4-methyl-2,7-diphenyl-1,4-oxazepan-5-one (PubChem CID 68605942) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 6-amino-4-methyl-2,7-diphenyl-1,4-oxazepan-5-one.
| Compound Name | 6-amino-4-methyl-2,7-diphenyl-1,4-oxazepan-5-one |
|---|---|
| PubChem CID | 68605942 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 6-amino-4-methyl-2,7-diphenyl-1,4-oxazepan-5-one |
| SMILES | CN1CC(c2ccccc2)OC(c2ccccc2)C(N)C1=O |
| InChI | InChI=1S/C18H20N2O2/c1-20-12-15(13-8-4-2-5-9-13)22-17(16(19)18(20)21)14-10-6-3-7-11-14/h2-11,15-17H,12,19H2,1H3 |
| InChIKey | RRYIUQDOLDYOPT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |