C12H16FN3 — CID 68606008
N'-[2-(5-fluoro-7H-indol-3-yl)ethyl]ethane-1,2-diamine (PubChem CID 68606008) has the molecular formula C12H16FN3 and a molecular weight of 221.28 g/mol. Its IUPAC name is N'-[2-(5-fluoro-7H-indol-3-yl)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(5-fluoro-7H-indol-3-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 68606008 |
| Molecular Formula | C12H16FN3 |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | N'-[2-(5-fluoro-7H-indol-3-yl)ethyl]ethane-1,2-diamine |
| SMILES | NCCNCCC1=CN=C2CC=C(F)C=C12 |
| InChI | InChI=1S/C12H16FN3/c13-10-1-2-12-11(7-10)9(8-16-12)3-5-15-6-4-14/h1,7-8,15H,2-6,14H2 |
| InChIKey | KWMXKAPTKXGSHG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|