C13H13FN2 — CID 69401793
5-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-7H-indole (PubChem CID 69401793) has the molecular formula C13H13FN2 and a molecular weight of 216.26 g/mol. Its IUPAC name is 5-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-7H-indole.
| Compound Name | 5-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-7H-indole |
|---|---|
| PubChem CID | 69401793 |
| Molecular Formula | C13H13FN2 |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 5-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-7H-indole |
| SMILES | FC1=CCC2=NC=C(C3=CCNCC3)C2=C1 |
| InChI | InChI=1S/C13H13FN2/c14-10-1-2-13-11(7-10)12(8-16-13)9-3-5-15-6-4-9/h1,3,7-8,15H,2,4-6H2 |
| InChIKey | SYTUMNSBTPQTLO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |