C37H48F2N4O4 — CID 68608395
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[2-[hydroxy(phenyl)methyl]-4-methylpiperazin-1-yl]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 68608395) has the molecular formula C37H48F2N4O4 and a molecular weight of 650.81 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[2-[hydroxy(phenyl)methyl]-4-methylpiperazin-1-yl]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[2-[hydroxy(phenyl)methyl]-4-methylpiperazin-1-yl]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 68608395 |
| Molecular Formula | C37H48F2N4O4 |
| Molecular Weight | 650.81 g/mol |
| Exact Mass | 650.36 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[2-[hydroxy(phenyl)methyl]-4-methylpiperazin-1-yl]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CN2CCN(C)CC2C(O)c2ccccc2)c1 |
| InChI | InChI=1S/C37H48F2N4O4/c1-5-12-42(13-6-2)37(47)29-17-25(3)16-28(21-29)36(46)40-32(20-26-18-30(38)22-31(39)19-26)34(44)24-43-15-14-41(4)23-33(43)35(45)27-10-8-7-9-11-27/h7-11,16-19,21-22,32-35,44-45H,5-6,12-15,20,23-24H2,1-4H3,(H,40,46)/t32-,33?,34+,35?/m0/s1 |
| InChIKey | ACIGQVPYOVHURD-CXUMPJCRSA-N |
| XLogP | 4.59 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.81 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |