C25H30F2N6O5S2 — CID 68608468
N'-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)butanediamide (PubChem CID 68608468) has the molecular formula C25H30F2N6O5S2 and a molecular weight of 596.68 g/mol. Its IUPAC name is N'-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)butanediamide.
| Compound Name | N'-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 68608468 |
| Molecular Formula | C25H30F2N6O5S2 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | N'-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)butanediamide |
| SMILES | CCc1cccc(CNC[C@@H](O)[C@H](Cc2cc(F)cc(F)c2)NC(=O)CCC(=O)Nc2nnc(S(N)(=O)=O)s2)c1 |
| InChI | InChI=1S/C25H30F2N6O5S2/c1-2-15-4-3-5-16(8-15)13-29-14-21(34)20(11-17-9-18(26)12-19(27)10-17)30-22(35)6-7-23(36)31-24-32-33-25(39-24)40(28,37)38/h3-5,8-10,12,20-21,29,34H,2,6-7,11,13-14H2,1H3,(H,30,35)(H2,28,37,38)(H,31,32,36)/t20-,21+/m0/s1 |
| InChIKey | KVKBBGRFILEATA-LEWJYISDSA-N |
| XLogP | 1.62 |
| TPSA | 176.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|