C32H42N4O5S — CID 68609200
1-N-[(2S)-3-hydroxy-1-phenyl-4-[2-(4-sulfamoylphenyl)ethylamino]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 68609200) has the molecular formula C32H42N4O5S and a molecular weight of 594.78 g/mol. Its IUPAC name is 1-N-[(2S)-3-hydroxy-1-phenyl-4-[2-(4-sulfamoylphenyl)ethylamino]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S)-3-hydroxy-1-phenyl-4-[2-(4-sulfamoylphenyl)ethylamino]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 68609200 |
| Molecular Formula | C32H42N4O5S |
| Molecular Weight | 594.78 g/mol |
| Exact Mass | 594.29 |
| IUPAC Name | 1-N-[(2S)-3-hydroxy-1-phenyl-4-[2-(4-sulfamoylphenyl)ethylamino]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)N[C@@H](Cc2ccccc2)C(O)CNCCc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C32H42N4O5S/c1-3-19-36(20-4-2)32(39)27-12-8-11-26(22-27)31(38)35-29(21-25-9-6-5-7-10-25)30(37)23-34-18-17-24-13-15-28(16-14-24)42(33,40)41/h5-16,22,29-30,34,37H,3-4,17-21,23H2,1-2H3,(H,35,38)(H2,33,40,41)/t29-,30?/m0/s1 |
| InChIKey | GZQOGUQFFMETSQ-UFXYQILXSA-N |
| XLogP | 3.13 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.78 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|