C31H38ClN3O3 — CID 139979471
1-N-[(2S,3R)-4-[[chloro(phenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 139979471) has the molecular formula C31H38ClN3O3 and a molecular weight of 536.12 g/mol. Its IUPAC name is 1-N-[(2S,3R)-4-[[chloro(phenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-4-[[chloro(phenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 139979471 |
| Molecular Formula | C31H38ClN3O3 |
| Molecular Weight | 536.12 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | 1-N-[(2S,3R)-4-[[chloro(phenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)N[C@@H](Cc2ccccc2)[C@H](O)CNC(Cl)c2ccccc2)c1 |
| InChI | InChI=1S/C31H38ClN3O3/c1-3-18-35(19-4-2)31(38)26-17-11-16-25(21-26)30(37)34-27(20-23-12-7-5-8-13-23)28(36)22-33-29(32)24-14-9-6-10-15-24/h5-17,21,27-29,33,36H,3-4,18-20,22H2,1-2H3,(H,34,37)/t27-,28+,29?/m0/s1 |
| InChIKey | HSLRCEWTUJRNPB-POZJPKTBSA-N |
| XLogP | 5.18 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.12 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|