C31H46N4O3 — CID 58737879
1-N-[(2S,3S,5R)-3-amino-5-methyl-6-(2-methylpropylamino)-6-oxo-1-phenylhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 58737879) has the molecular formula C31H46N4O3 and a molecular weight of 522.73 g/mol. Its IUPAC name is 1-N-[(2S,3S,5R)-3-amino-5-methyl-6-(2-methylpropylamino)-6-oxo-1-phenylhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3S,5R)-3-amino-5-methyl-6-(2-methylpropylamino)-6-oxo-1-phenylhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 58737879 |
| Molecular Formula | C31H46N4O3 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.36 |
| IUPAC Name | 1-N-[(2S,3S,5R)-3-amino-5-methyl-6-(2-methylpropylamino)-6-oxo-1-phenylhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)N[C@@H](Cc2ccccc2)[C@@H](N)C[C@@H](C)C(=O)NCC(C)C)c1 |
| InChI | InChI=1S/C31H46N4O3/c1-6-16-35(17-7-2)31(38)26-15-11-14-25(20-26)30(37)34-28(19-24-12-9-8-10-13-24)27(32)18-23(5)29(36)33-21-22(3)4/h8-15,20,22-23,27-28H,6-7,16-19,21,32H2,1-5H3,(H,33,36)(H,34,37)/t23-,27+,28+/m1/s1 |
| InChIKey | LLWASRWKAUDANP-UIUQJESISA-N |
| XLogP | 4.42 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |