C34H49FN4O3 — CID 58738165
1-N-[(2S,3S,5R)-3-amino-6-(cyclohexylmethylamino)-1-(3-fluorophenyl)-5-methyl-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 58738165) has the molecular formula C34H49FN4O3 and a molecular weight of 580.79 g/mol. Its IUPAC name is 1-N-[(2S,3S,5R)-3-amino-6-(cyclohexylmethylamino)-1-(3-fluorophenyl)-5-methyl-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3S,5R)-3-amino-6-(cyclohexylmethylamino)-1-(3-fluorophenyl)-5-methyl-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 58738165 |
| Molecular Formula | C34H49FN4O3 |
| Molecular Weight | 580.79 g/mol |
| Exact Mass | 580.38 |
| IUPAC Name | 1-N-[(2S,3S,5R)-3-amino-6-(cyclohexylmethylamino)-1-(3-fluorophenyl)-5-methyl-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)N[C@@H](Cc2cccc(F)c2)[C@@H](N)C[C@@H](C)C(=O)NCC2CCCCC2)c1 |
| InChI | InChI=1S/C34H49FN4O3/c1-4-17-39(18-5-2)34(42)28-15-10-14-27(22-28)33(41)38-31(21-26-13-9-16-29(35)20-26)30(36)19-24(3)32(40)37-23-25-11-7-6-8-12-25/h9-10,13-16,20,22,24-25,30-31H,4-8,11-12,17-19,21,23,36H2,1-3H3,(H,37,40)(H,38,41)/t24-,30+,31+/m1/s1 |
| InChIKey | RFUUZYGSQHTANB-GTTXMTDLSA-N |
| XLogP | 5.48 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.79 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |