C28H41N5O3S — CID 58737913
1-N-[(2S,3S,5R)-3-amino-6-(cyclopropylmethylamino)-5-methyl-6-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 58737913) has the molecular formula C28H41N5O3S and a molecular weight of 527.74 g/mol. Its IUPAC name is 1-N-[(2S,3S,5R)-3-amino-6-(cyclopropylmethylamino)-5-methyl-6-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3S,5R)-3-amino-6-(cyclopropylmethylamino)-5-methyl-6-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 58737913 |
| Molecular Formula | C28H41N5O3S |
| Molecular Weight | 527.74 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | 1-N-[(2S,3S,5R)-3-amino-6-(cyclopropylmethylamino)-5-methyl-6-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)N[C@@H](Cc2nccs2)[C@@H](N)C[C@@H](C)C(=O)NCC2CC2)c1 |
| InChI | InChI=1S/C28H41N5O3S/c1-4-12-33(13-5-2)28(36)22-8-6-7-21(16-22)27(35)32-24(17-25-30-11-14-37-25)23(29)15-19(3)26(34)31-18-20-9-10-20/h6-8,11,14,16,19-20,23-24H,4-5,9-10,12-13,15,17-18,29H2,1-3H3,(H,31,34)(H,32,35)/t19-,23+,24+/m1/s1 |
| InChIKey | ZJQKTWYDBLECDX-YGOYIFOWSA-N |
| XLogP | 3.63 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.74 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |