C33H46F2N4O3 — CID 58738224
1-N-[(2S,3S,5R)-3-amino-6-(cyclopentylmethylamino)-1-(2,3-difluorophenyl)-5-methyl-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 58738224) has the molecular formula C33H46F2N4O3 and a molecular weight of 584.75 g/mol. Its IUPAC name is 1-N-[(2S,3S,5R)-3-amino-6-(cyclopentylmethylamino)-1-(2,3-difluorophenyl)-5-methyl-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3S,5R)-3-amino-6-(cyclopentylmethylamino)-1-(2,3-difluorophenyl)-5-methyl-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 58738224 |
| Molecular Formula | C33H46F2N4O3 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.35 |
| IUPAC Name | 1-N-[(2S,3S,5R)-3-amino-6-(cyclopentylmethylamino)-1-(2,3-difluorophenyl)-5-methyl-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)N[C@@H](Cc2cccc(F)c2F)[C@@H](N)C[C@@H](C)C(=O)NCC2CCCC2)c1 |
| InChI | InChI=1S/C33H46F2N4O3/c1-4-16-39(17-5-2)33(42)26-14-8-13-25(19-26)32(41)38-29(20-24-12-9-15-27(34)30(24)35)28(36)18-22(3)31(40)37-21-23-10-6-7-11-23/h8-9,12-15,19,22-23,28-29H,4-7,10-11,16-18,20-21,36H2,1-3H3,(H,37,40)(H,38,41)/t22-,28+,29+/m1/s1 |
| InChIKey | TVYDUYBBXGKMPC-YDTRGFDASA-N |
| XLogP | 5.23 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |