C29H44N4O3S — CID 58737936
1-N-[(2S,3S,5R)-3-amino-5-methyl-6-(2-methylpropylamino)-6-oxo-1-thiophen-2-ylhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 58737936) has the molecular formula C29H44N4O3S and a molecular weight of 528.76 g/mol. Its IUPAC name is 1-N-[(2S,3S,5R)-3-amino-5-methyl-6-(2-methylpropylamino)-6-oxo-1-thiophen-2-ylhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3S,5R)-3-amino-5-methyl-6-(2-methylpropylamino)-6-oxo-1-thiophen-2-ylhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 58737936 |
| Molecular Formula | C29H44N4O3S |
| Molecular Weight | 528.76 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | 1-N-[(2S,3S,5R)-3-amino-5-methyl-6-(2-methylpropylamino)-6-oxo-1-thiophen-2-ylhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)N[C@@H](Cc2cccs2)[C@@H](N)C[C@@H](C)C(=O)NCC(C)C)c1 |
| InChI | InChI=1S/C29H44N4O3S/c1-6-13-33(14-7-2)29(36)23-11-8-10-22(17-23)28(35)32-26(18-24-12-9-15-37-24)25(30)16-21(5)27(34)31-19-20(3)4/h8-12,15,17,20-21,25-26H,6-7,13-14,16,18-19,30H2,1-5H3,(H,31,34)(H,32,35)/t21-,25+,26+/m1/s1 |
| InChIKey | ZZXYCUGGQYLWOB-NYMACZPPSA-N |
| XLogP | 4.48 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.76 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |