C31H46N4O4 — CID 58737701
1-N-[(2S,3S,5R)-3-amino-6-(cyclopentylmethylamino)-1-(furan-3-yl)-5-methyl-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 58737701) has the molecular formula C31H46N4O4 and a molecular weight of 538.73 g/mol. Its IUPAC name is 1-N-[(2S,3S,5R)-3-amino-6-(cyclopentylmethylamino)-1-(furan-3-yl)-5-methyl-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3S,5R)-3-amino-6-(cyclopentylmethylamino)-1-(furan-3-yl)-5-methyl-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 58737701 |
| Molecular Formula | C31H46N4O4 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.35 |
| IUPAC Name | 1-N-[(2S,3S,5R)-3-amino-6-(cyclopentylmethylamino)-1-(furan-3-yl)-5-methyl-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)N[C@@H](Cc2ccoc2)[C@@H](N)C[C@@H](C)C(=O)NCC2CCCC2)c1 |
| InChI | InChI=1S/C31H46N4O4/c1-4-14-35(15-5-2)31(38)26-12-8-11-25(19-26)30(37)34-28(18-24-13-16-39-21-24)27(32)17-22(3)29(36)33-20-23-9-6-7-10-23/h8,11-13,16,19,21-23,27-28H,4-7,9-10,14-15,17-18,20,32H2,1-3H3,(H,33,36)(H,34,37)/t22-,27+,28+/m1/s1 |
| InChIKey | ZGMQFCBVBBTMHF-WWEDSPNTSA-N |
| XLogP | 4.54 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |