C29H42N4O4 — CID 58738071
1-N-[(2S,3S,5R)-3-amino-6-(cyclopropylmethylamino)-1-(furan-3-yl)-5-methyl-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 58738071) has the molecular formula C29H42N4O4 and a molecular weight of 510.68 g/mol. Its IUPAC name is 1-N-[(2S,3S,5R)-3-amino-6-(cyclopropylmethylamino)-1-(furan-3-yl)-5-methyl-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3S,5R)-3-amino-6-(cyclopropylmethylamino)-1-(furan-3-yl)-5-methyl-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 58738071 |
| Molecular Formula | C29H42N4O4 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.32 |
| IUPAC Name | 1-N-[(2S,3S,5R)-3-amino-6-(cyclopropylmethylamino)-1-(furan-3-yl)-5-methyl-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)N[C@@H](Cc2ccoc2)[C@@H](N)C[C@@H](C)C(=O)NCC2CC2)c1 |
| InChI | InChI=1S/C29H42N4O4/c1-4-12-33(13-5-2)29(36)24-8-6-7-23(17-24)28(35)32-26(16-22-11-14-37-19-22)25(30)15-20(3)27(34)31-18-21-9-10-21/h6-8,11,14,17,19-21,25-26H,4-5,9-10,12-13,15-16,18,30H2,1-3H3,(H,31,34)(H,32,35)/t20-,25+,26+/m1/s1 |
| InChIKey | OPGVSIQFUQIFFS-BQQUOAEZSA-N |
| XLogP | 3.76 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |