C30H50N4O3 — CID 58737855
1-N-[(3S,4S,6R)-4-amino-1-cyclopropyl-6-methyl-7-[[(2S)-2-methylbutyl]amino]-7-oxoheptan-3-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 58737855) has the molecular formula C30H50N4O3 and a molecular weight of 514.76 g/mol. Its IUPAC name is 1-N-[(3S,4S,6R)-4-amino-1-cyclopropyl-6-methyl-7-[[(2S)-2-methylbutyl]amino]-7-oxoheptan-3-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(3S,4S,6R)-4-amino-1-cyclopropyl-6-methyl-7-[[(2S)-2-methylbutyl]amino]-7-oxoheptan-3-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 58737855 |
| Molecular Formula | C30H50N4O3 |
| Molecular Weight | 514.76 g/mol |
| Exact Mass | 514.39 |
| IUPAC Name | 1-N-[(3S,4S,6R)-4-amino-1-cyclopropyl-6-methyl-7-[[(2S)-2-methylbutyl]amino]-7-oxoheptan-3-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)N[C@@H](CCC2CC2)[C@@H](N)C[C@@H](C)C(=O)NC[C@@H](C)CC)c1 |
| InChI | InChI=1S/C30H50N4O3/c1-6-16-34(17-7-2)30(37)25-11-9-10-24(19-25)29(36)33-27(15-14-23-12-13-23)26(31)18-22(5)28(35)32-20-21(4)8-3/h9-11,19,21-23,26-27H,6-8,12-18,20,31H2,1-5H3,(H,32,35)(H,33,36)/t21-,22+,26-,27-/m0/s1 |
| InChIKey | GKPIFDRQBLCWKT-ZKBLBJRCSA-N |
| XLogP | 4.75 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.76 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |