C32H46F2N4O3 — CID 58738097
1-N-[(2S,3S,5R)-3-amino-1-(2,3-difluorophenyl)-5-methyl-6-[[(2S)-2-methylbutyl]amino]-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 58738097) has the molecular formula C32H46F2N4O3 and a molecular weight of 572.74 g/mol. Its IUPAC name is 1-N-[(2S,3S,5R)-3-amino-1-(2,3-difluorophenyl)-5-methyl-6-[[(2S)-2-methylbutyl]amino]-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3S,5R)-3-amino-1-(2,3-difluorophenyl)-5-methyl-6-[[(2S)-2-methylbutyl]amino]-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 58738097 |
| Molecular Formula | C32H46F2N4O3 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.35 |
| IUPAC Name | 1-N-[(2S,3S,5R)-3-amino-1-(2,3-difluorophenyl)-5-methyl-6-[[(2S)-2-methylbutyl]amino]-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)N[C@@H](Cc2cccc(F)c2F)[C@@H](N)C[C@@H](C)C(=O)NC[C@@H](C)CC)c1 |
| InChI | InChI=1S/C32H46F2N4O3/c1-6-15-38(16-7-2)32(41)25-13-9-12-24(18-25)31(40)37-28(19-23-11-10-14-26(33)29(23)34)27(35)17-22(5)30(39)36-20-21(4)8-3/h9-14,18,21-22,27-28H,6-8,15-17,19-20,35H2,1-5H3,(H,36,39)(H,37,40)/t21-,22+,27-,28-/m0/s1 |
| InChIKey | KLIWRHKYHNTLRA-DEQMQSMYSA-N |
| XLogP | 5.08 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |