C38H53F2N3O6 — CID 10327259
methyl 4-[[[(2R,4S,5S)-6-(3,5-difluorophenyl)-5-[[3-(dipropylcarbamoyl)benzoyl]amino]-4-hydroxy-2-propylhexanoyl]amino]methyl]cyclohexane-1-carboxylate (PubChem CID 10327259) has the molecular formula C38H53F2N3O6 and a molecular weight of 685.85 g/mol. Its IUPAC name is methyl 4-[[[(2R,4S,5S)-6-(3,5-difluorophenyl)-5-[[3-(dipropylcarbamoyl)benzoyl]amino]-4-hydroxy-2-propylhexanoyl]amino]methyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[[(2R,4S,5S)-6-(3,5-difluorophenyl)-5-[[3-(dipropylcarbamoyl)benzoyl]amino]-4-hydroxy-2-propylhexanoyl]amino]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10327259 |
| Molecular Formula | C38H53F2N3O6 |
| Molecular Weight | 685.85 g/mol |
| Exact Mass | 685.39 |
| IUPAC Name | methyl 4-[[[(2R,4S,5S)-6-(3,5-difluorophenyl)-5-[[3-(dipropylcarbamoyl)benzoyl]amino]-4-hydroxy-2-propylhexanoyl]amino]methyl]cyclohexane-1-carboxylate |
| SMILES | CCC[C@H](C[C@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)c1cccc(C(=O)N(CCC)CCC)c1)C(=O)NCC1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C38H53F2N3O6/c1-5-9-28(35(45)41-24-25-12-14-27(15-13-25)38(48)49-4)22-34(44)33(20-26-18-31(39)23-32(40)19-26)42-36(46)29-10-8-11-30(21-29)37(47)43(16-6-2)17-7-3/h8,10-11,18-19,21,23,25,27-28,33-34,44H,5-7,9,12-17,20,22,24H2,1-4H3,(H,41,45)(H,42,46)/t25?,27?,28-,33+,34+/m1/s1 |
| InChIKey | ZNFNIHHBTFGAGU-FIBDTBICSA-N |
| XLogP | 5.83 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.85 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |