C34H52N6O2 — CID 142843651
1-N-[(2S,3S,5R)-3-amino-5-methyl-6-[3-methyl-4-(2-methylpropyl)-2H-triazol-1-yl]-1-phenylhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 142843651) has the molecular formula C34H52N6O2 and a molecular weight of 576.83 g/mol. Its IUPAC name is 1-N-[(2S,3S,5R)-3-amino-5-methyl-6-[3-methyl-4-(2-methylpropyl)-2H-triazol-1-yl]-1-phenylhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3S,5R)-3-amino-5-methyl-6-[3-methyl-4-(2-methylpropyl)-2H-triazol-1-yl]-1-phenylhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 142843651 |
| Molecular Formula | C34H52N6O2 |
| Molecular Weight | 576.83 g/mol |
| Exact Mass | 576.42 |
| IUPAC Name | 1-N-[(2S,3S,5R)-3-amino-5-methyl-6-[3-methyl-4-(2-methylpropyl)-2H-triazol-1-yl]-1-phenylhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)N[C@@H](Cc2ccccc2)[C@@H](N)C[C@@H](C)CN2C=C(CC(C)C)N(C)N2)c1 |
| InChI | InChI=1S/C34H52N6O2/c1-7-17-39(18-8-2)34(42)29-16-12-15-28(22-29)33(41)36-32(21-27-13-10-9-11-14-27)31(35)20-26(5)23-40-24-30(19-25(3)4)38(6)37-40/h9-16,22,24-26,31-32,37H,7-8,17-21,23,35H2,1-6H3,(H,36,41)/t26-,31+,32+/m1/s1 |
| InChIKey | KMUDBDOYBSYNPC-GWTOPCPNSA-N |
| XLogP | 5.20 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.83 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |