C4H6BrNS — CID 68609538
4-bromo-2-methyl-4,5-dihydro-1,3-thiazole (PubChem CID 68609538) has the molecular formula C4H6BrNS and a molecular weight of 180.07 g/mol. Its IUPAC name is 4-bromo-2-methyl-4,5-dihydro-1,3-thiazole.
| Compound Name | 4-bromo-2-methyl-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 68609538 |
| Molecular Formula | C4H6BrNS |
| Molecular Weight | 180.07 g/mol |
| Exact Mass | 178.94 |
| IUPAC Name | 4-bromo-2-methyl-4,5-dihydro-1,3-thiazole |
| SMILES | CC1=NC(Br)CS1 |
| InChI | InChI=1S/C4H6BrNS/c1-3-6-4(5)2-7-3/h4H,2H2,1H3 |
| InChIKey | KQOIMOBDKLPGPM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.07 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|