C25H29N5O4S — CID 68610014
tert-butyl N-[4-[3-cyano-2-(3-pyridin-3-ylprop-2-enoylamino)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]-4-oxobutyl]carbamate (PubChem CID 68610014) has the molecular formula C25H29N5O4S and a molecular weight of 495.61 g/mol. Its IUPAC name is tert-butyl N-[4-[3-cyano-2-(3-pyridin-3-ylprop-2-enoylamino)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-cyano-2-(3-pyridin-3-ylprop-2-enoylamino)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 68610014 |
| Molecular Formula | C25H29N5O4S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | tert-butyl N-[4-[3-cyano-2-(3-pyridin-3-ylprop-2-enoylamino)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]-4-oxobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)N1CCc2c(sc(NC(=O)C=Cc3cccnc3)c2C#N)C1 |
| InChI | InChI=1S/C25H29N5O4S/c1-25(2,3)34-24(33)28-12-5-7-22(32)30-13-10-18-19(14-26)23(35-20(18)16-30)29-21(31)9-8-17-6-4-11-27-15-17/h4,6,8-9,11,15H,5,7,10,12-13,16H2,1-3H3,(H,28,33)(H,29,31) |
| InChIKey | OKFZRKQWCXIJFO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|