C20H20N4O2S — CID 69111948
(E)-N-(6-butanoyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-3-pyridin-2-ylprop-2-enamide (PubChem CID 69111948) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is (E)-N-(6-butanoyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-3-pyridin-2-ylprop-2-enamide.
| Compound Name | (E)-N-(6-butanoyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-3-pyridin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 69111948 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (E)-N-(6-butanoyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-3-pyridin-2-ylprop-2-enamide |
| SMILES | CCCC(=O)N1CCc2c(sc(NC(=O)/C=C/c3ccccn3)c2C#N)C1 |
| InChI | InChI=1S/C20H20N4O2S/c1-2-5-19(26)24-11-9-15-16(12-21)20(27-17(15)13-24)23-18(25)8-7-14-6-3-4-10-22-14/h3-4,6-8,10H,2,5,9,11,13H2,1H3,(H,23,25)/b8-7+ |
| InChIKey | VRUXMAHMQVEAHB-BQYQJAHWSA-N |
| XLogP | 3.35 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|