C18H16ClN3OS — CID 68611412
3-(2-chloro-3-methylphenyl)-N-(3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)prop-2-enamide (PubChem CID 68611412) has the molecular formula C18H16ClN3OS and a molecular weight of 357.87 g/mol. Its IUPAC name is 3-(2-chloro-3-methylphenyl)-N-(3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)prop-2-enamide.
| Compound Name | 3-(2-chloro-3-methylphenyl)-N-(3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 68611412 |
| Molecular Formula | C18H16ClN3OS |
| Molecular Weight | 357.87 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 3-(2-chloro-3-methylphenyl)-N-(3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)prop-2-enamide |
| SMILES | Cc1cccc(C=CC(=O)Nc2sc3c(c2C#N)CCNC3)c1Cl |
| InChI | InChI=1S/C18H16ClN3OS/c1-11-3-2-4-12(17(11)19)5-6-16(23)22-18-14(9-20)13-7-8-21-10-15(13)24-18/h2-6,21H,7-8,10H2,1H3,(H,22,23) |
| InChIKey | FCAQMYVUENIRJD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.87 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|