C19H19N3O3S — CID 68611951
N-(3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)-3-(2,3-dimethoxyphenyl)prop-2-enamide (PubChem CID 68611951) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)-3-(2,3-dimethoxyphenyl)prop-2-enamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)-3-(2,3-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 68611951 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)-3-(2,3-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(C=CC(=O)Nc2sc3c(c2C#N)CCNC3)c1OC |
| InChI | InChI=1S/C19H19N3O3S/c1-24-15-5-3-4-12(18(15)25-2)6-7-17(23)22-19-14(10-20)13-8-9-21-11-16(13)26-19/h3-7,21H,8-9,11H2,1-2H3,(H,22,23) |
| InChIKey | CUKNJVJBOJZOQW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|