C22H28N2O3 — CID 68611505
3-[[(2S)-azetidin-2-yl]methoxy]-5-[(1S,2R)-2-[2-[(4-methoxyphenyl)methoxy]ethyl]cyclopropyl]pyridine (PubChem CID 68611505) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 3-[[(2S)-azetidin-2-yl]methoxy]-5-[(1S,2R)-2-[2-[(4-methoxyphenyl)methoxy]ethyl]cyclopropyl]pyridine.
| Compound Name | 3-[[(2S)-azetidin-2-yl]methoxy]-5-[(1S,2R)-2-[2-[(4-methoxyphenyl)methoxy]ethyl]cyclopropyl]pyridine |
|---|---|
| PubChem CID | 68611505 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 3-[[(2S)-azetidin-2-yl]methoxy]-5-[(1S,2R)-2-[2-[(4-methoxyphenyl)methoxy]ethyl]cyclopropyl]pyridine |
| SMILES | COc1ccc(COCC[C@H]2C[C@@H]2c2cncc(OC[C@@H]3CCN3)c2)cc1 |
| InChI | InChI=1S/C22H28N2O3/c1-25-20-4-2-16(3-5-20)14-26-9-7-17-11-22(17)18-10-21(13-23-12-18)27-15-19-6-8-24-19/h2-5,10,12-13,17,19,22,24H,6-9,11,14-15H2,1H3/t17-,19-,22-/m0/s1 |
| InChIKey | JJCJCVKNFVJJJY-JLMWRMLUSA-N |
| XLogP | 3.54 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|